| Name |
2-(2,6-dioxopiperidin-3-yl)-5-({4H,5H,6H,7H,8H-pyrazolo[1,5-a][1,4]diazepin-7-yl}amino)-2,3-dihydro-1H-isoindole-1,3-dione
|
| Molecular Formula |
C20H20N6O4
|
| Molecular Weight |
408.4
|
| Smiles |
O=C1CCC(N2C(=O)c3ccc(NC4CNCc5ccnn5C4)cc3C2=O)C(=O)N1
|
O=C1CCC(N2C(=O)c3ccc(NC4CNCc5ccnn5C4)cc3C2=O)C(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.