| Name |
6-bromo-2H-1lambda6,2,3-benzothiadiazine-1,1-dione
|
| Molecular Formula |
C7H5BrN2O2S
|
| Molecular Weight |
261.10
|
| Smiles |
O=S1(=O)NN=Cc2cc(Br)ccc21
|
O=S1(=O)NN=Cc2cc(Br)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.