| Name |
4-{[(9R)-2-methyl-5H,6H,7H,8H,9H-imidazo[1,2-a][1,4]diazepin-9-yl]methyl}-1H-imidazole
|
| Molecular Formula |
C12H17N5
|
| Molecular Weight |
231.30
|
| Smiles |
Cc1cn2c(n1)C(Cc1cnc[nH]1)NCCC2
|
Cc1cn2c(n1)C(Cc1cnc[nH]1)NCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.