| Name |
1-Acetyl-4',7'-dihydrospiro[piperidine-4,6'-pyrazolo[3,2-c][1,4]oxazine]-2'-carboxylic acid
|
| Molecular Formula |
C13H17N3O4
|
| Molecular Weight |
279.29
|
| Smiles |
CC(=O)N1CCC2(CC1)Cn1nc(C(=O)O)cc1CO2
|
CC(=O)N1CCC2(CC1)Cn1nc(C(=O)O)cc1CO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.