| Name |
(E)-Bis(4-bromo-2,6-dimethylphenyl)diazene
|
| Molecular Formula |
C16H16Br2N2
|
| Molecular Weight |
396.12
|
| Smiles |
Cc1cc(Br)cc(C)c1N=Nc1c(C)cc(Br)cc1C
|
Cc1cc(Br)cc(C)c1N=Nc1c(C)cc(Br)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.