| Name |
2-(3-bromo-2,2-dimethylpropyl)-4,5,6,7-tetrahydro-1H-indole
|
| Molecular Formula |
C13H20BrN
|
| Molecular Weight |
270.21
|
| Smiles |
CC(C)(CBr)Cc1cc2c([nH]1)CCCC2
|
CC(C)(CBr)Cc1cc2c([nH]1)CCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.