| Name |
tert-butyl 4-{5-tert-butyl-4-[(chloromethoxy)carbonyl]-1H-1,2,3-triazol-1-yl}piperidine-1-carboxylate
|
| Molecular Formula |
C18H29ClN4O4
|
| Molecular Weight |
400.9
|
| Smiles |
CC(C)(C)OC(=O)N1CCC(n2nnc(C(=O)OCCl)c2C(C)(C)C)CC1
|
CC(C)(C)OC(=O)N1CCC(n2nnc(C(=O)OCCl)c2C(C)(C)C)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.