| Name |
1-tert-butyl 2-chloromethyl 4-(aminomethyl)-2,3-dihydro-1H-indole-1,2-dicarboxylate
|
| Molecular Formula |
C16H21ClN2O4
|
| Molecular Weight |
340.80
|
| Smiles |
CC(C)(C)OC(=O)N1c2cccc(CN)c2CC1C(=O)OCCl
|
CC(C)(C)OC(=O)N1c2cccc(CN)c2CC1C(=O)OCCl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.