| Name |
2-{4-[3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propyl]-1H-1,2,3-triazol-1-yl}acetic acid
|
| Molecular Formula |
C22H22N4O4
|
| Molecular Weight |
406.4
|
| Smiles |
O=C(O)Cn1cc(CCCNC(=O)OCC2c3ccccc3-c3ccccc32)nn1
|
O=C(O)Cn1cc(CCCNC(=O)OCC2c3ccccc3-c3ccccc32)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.