| Name |
3-methyl-2,4-dioxo-1-propyl-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-6-sulfonyl fluoride
|
| Molecular Formula |
C11H12FN3O4S
|
| Molecular Weight |
301.30
|
| Smiles |
CCCn1c(=O)n(C)c(=O)c2cc(S(=O)(=O)F)cnc21
|
CCCn1c(=O)n(C)c(=O)c2cc(S(=O)(=O)F)cnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.