| Name |
2-(1-{pyrazolo[1,5-a]pyrimidin-5-yl}azetidin-3-yl)-2H-1,2,3-triazole
|
| Molecular Formula |
C11H11N7
|
| Molecular Weight |
241.25
|
| Smiles |
c1cnn(C2CN(c3ccn4nccc4n3)C2)n1
|
c1cnn(C2CN(c3ccn4nccc4n3)C2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.