| Name |
2-(4-{furo[3,2-c]pyridin-4-yl}piperazin-1-yl)-N,N,6-trimethylpyrimidin-4-amine
|
| Molecular Formula |
C18H22N6O
|
| Molecular Weight |
338.4
|
| Smiles |
Cc1cc(N(C)C)nc(N2CCN(c3nccc4occc34)CC2)n1
|
Cc1cc(N(C)C)nc(N2CCN(c3nccc4occc34)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.