| Name |
4-cyclohexyl-5-(1,1-difluoropropyl)-4H-1,2,4-triazole-3-thiol
|
| Molecular Formula |
C11H17F2N3S
|
| Molecular Weight |
261.34
|
| Smiles |
CCC(F)(F)c1n[nH]c(=S)n1C1CCCCC1
|
CCC(F)(F)c1n[nH]c(=S)n1C1CCCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.