| Name |
1-methyl-3-{6H,7H,8H,9H-pyrido[2,3-b]1,6-naphthyridine-7-carbonyl}-1H-pyrazole
|
| Molecular Formula |
C16H15N5O
|
| Molecular Weight |
293.32
|
| Smiles |
Cn1ccc(C(=O)N2CCc3nc4ncccc4cc3C2)n1
|
Cn1ccc(C(=O)N2CCc3nc4ncccc4cc3C2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.