| Name |
2,7-bis(difluoromethyl)-4H,5H,6H,7H-[1,2,4]triazolo[1,5-a]pyrimidine
|
| Molecular Formula |
C7H8F4N4
|
| Molecular Weight |
224.16
|
| Smiles |
FC(F)c1nc2n(n1)C(C(F)F)CCN2
|
FC(F)c1nc2n(n1)C(C(F)F)CCN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.