| Name |
3,3,3-Trifluoro-2-{pyrazolo[1,5-a]pyridin-3-yl}propan-1-amine
|
| Molecular Formula |
C10H10F3N3
|
| Molecular Weight |
229.20
|
| Smiles |
NCC(c1cnn2ccccc12)C(F)(F)F
|
NCC(c1cnn2ccccc12)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.