| Name |
1H-Indole, 7-fluoro-4-(2,3,4,5,6-pentafluorophenyl)-
|
| Molecular Formula |
C14H5F6N
|
| Molecular Weight |
301.19
|
| Smiles |
Fc1c(F)c(F)c(-c2ccc(F)c3[nH]ccc23)c(F)c1F
|
Fc1c(F)c(F)c(-c2ccc(F)c3[nH]ccc23)c(F)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.