| Name |
1-tert-butyl 5-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2,3-dihydro-1H-indole-1,5-dicarboxylate
|
| Molecular Formula |
C22H20N2O6
|
| Molecular Weight |
408.4
|
| Smiles |
CC(C)(C)OC(=O)N1CCc2cc(C(=O)ON3C(=O)c4ccccc4C3=O)ccc21
|
CC(C)(C)OC(=O)N1CCc2cc(C(=O)ON3C(=O)c4ccccc4C3=O)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.