| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(3,5-dimethoxyphenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoate
|
| Molecular Formula |
C34H28N2O8
|
| Molecular Weight |
592.6
|
| Smiles |
COc1cc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)ON2C(=O)c3ccccc3C2=O)cc(OC)c1
|
COc1cc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)ON2C(=O)c3ccccc3C2=O)cc(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.