| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 1,1-dioxo-2H,3H,4H-1lambda6-pyrazolo[1,5-e][1,2,5]thiadiazine-8-carboxylate
|
| Molecular Formula |
C14H10N4O6S
|
| Molecular Weight |
362.32
|
| Smiles |
O=C(ON1C(=O)c2ccccc2C1=O)c1cnn2c1S(=O)(=O)NCC2
|
O=C(ON1C(=O)c2ccccc2C1=O)c1cnn2c1S(=O)(=O)NCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.