| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-(2,2-difluoro-1,3-dioxaindan-5-yl)acetate
|
| Molecular Formula |
C17H9F2NO6
|
| Molecular Weight |
361.25
|
| Smiles |
O=C(Cc1ccc2c(c1)OC(F)(F)O2)ON1C(=O)c2ccccc2C1=O
|
O=C(Cc1ccc2c(c1)OC(F)(F)O2)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.