| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 4-methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate
|
| Molecular Formula |
C18H12N2O6
|
| Molecular Weight |
352.3
|
| Smiles |
CN1C(=O)COc2ccc(C(=O)ON3C(=O)c4ccccc4C3=O)cc21
|
CN1C(=O)COc2ccc(C(=O)ON3C(=O)c4ccccc4C3=O)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.