| Name |
benzyl N-{6-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-yl}carbamate
|
| Molecular Formula |
C14H11N5O4
|
| Molecular Weight |
313.27
|
| Smiles |
O=C(Nc1nc2ccc([N+](=O)[O-])cn2n1)OCc1ccccc1
|
O=C(Nc1nc2ccc([N+](=O)[O-])cn2n1)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.