| Name |
tert-butyl N-{3-bromo-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl}carbamate
|
| Molecular Formula |
C13H17BrN4O2
|
| Molecular Weight |
341.20
|
| Smiles |
Cc1cc(NC(=O)OC(C)(C)C)n2nc(C)c(Br)c2n1
|
Cc1cc(NC(=O)OC(C)(C)C)n2nc(C)c(Br)c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.