| Name |
Methyl 5-bromo-2-{[(tert-butoxy)carbonyl]amino}-4-methoxybenzoate
|
| Molecular Formula |
C14H18BrNO5
|
| Molecular Weight |
360.20
|
| Smiles |
COC(=O)c1cc(Br)c(OC)cc1NC(=O)OC(C)(C)C
|
COC(=O)c1cc(Br)c(OC)cc1NC(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.