| Name |
tert-butyl 2,2-dioxo-3H,5H,6H,7H,8H-2lambda6-pyrido[4,3-c][1,2,6]thiadiazine-3-carboxylate
|
| Molecular Formula |
C11H17N3O4S
|
| Molecular Weight |
287.34
|
| Smiles |
CC(C)(C)OC(=O)N1C=C2CNCCC2=NS1(=O)=O
|
CC(C)(C)OC(=O)N1C=C2CNCCC2=NS1(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.