| Name |
rac-tert-butyl N-[(1R,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylcarbamate
|
| Molecular Formula |
C16H23NO3
|
| Molecular Weight |
277.36
|
| Smiles |
CN(C(=O)OC(C)(C)C)C1c2ccccc2CCC1O
|
CN(C(=O)OC(C)(C)C)C1c2ccccc2CCC1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.