| Name |
tert-butyl 2-amino-4,4-difluoro-4H,5H,6H,7H,8H-cyclohepta[d][1,3]thiazole-7-carboxylate
|
| Molecular Formula |
C13H18F2N2O2S
|
| Molecular Weight |
304.36
|
| Smiles |
CC(C)(C)OC(=O)C1CCC(F)(F)c2nc(N)sc2C1
|
CC(C)(C)OC(=O)C1CCC(F)(F)c2nc(N)sc2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.