| Name |
2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 4-methyl 1-benzothiophene-2,4-dicarboxylate
|
| Molecular Formula |
C19H11NO6S
|
| Molecular Weight |
381.4
|
| Smiles |
COC(=O)c1cccc2sc(C(=O)ON3C(=O)c4ccccc4C3=O)cc12
|
COC(=O)c1cccc2sc(C(=O)ON3C(=O)c4ccccc4C3=O)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.