| Name |
methyl 3,3-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-5-carboxylate
|
| Molecular Formula |
C11H14N2O2
|
| Molecular Weight |
206.24
|
| Smiles |
COC(=O)c1ccc2c(n1)C(C)(C)CN2
|
COC(=O)c1ccc2c(n1)C(C)(C)CN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.