| Name |
5',7'-difluoro-3',4'-dihydro-2'H-spiro[cyclobutane-1,1'-naphthalene]-4'-amine
|
| Molecular Formula |
C13H15F2N
|
| Molecular Weight |
223.26
|
| Smiles |
NC1CCC2(CCC2)c2cc(F)cc(F)c21
|
NC1CCC2(CCC2)c2cc(F)cc(F)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.