| Name |
7'-(propan-2-yl)-3',4'-dihydro-2'H-spiro[cyclopropane-1,1'-naphthalene]-4'-amine
|
| Molecular Formula |
C15H21N
|
| Molecular Weight |
215.33
|
| Smiles |
CC(C)c1ccc2c(c1)C1(CCC2N)CC1
|
CC(C)c1ccc2c(c1)C1(CCC2N)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.