| Name |
4-{1-[4-(Trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidine-3-carbonyl}thiomorpholine
|
| Molecular Formula |
C13H16F3N3OS2
|
| Molecular Weight |
351.4
|
| Smiles |
O=C(C1CCN(c2nc(C(F)(F)F)cs2)C1)N1CCSCC1
|
O=C(C1CCN(c2nc(C(F)(F)F)cs2)C1)N1CCSCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.