| Name |
4,4-Difluoro-1-(1-{5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}pyrrolidine-3-carbonyl)piperidine
|
| Molecular Formula |
C16H20F2N6O
|
| Molecular Weight |
350.37
|
| Smiles |
Cc1cc(N2CCC(C(=O)N3CCC(F)(F)CC3)C2)n2ncnc2n1
|
Cc1cc(N2CCC(C(=O)N3CCC(F)(F)CC3)C2)n2ncnc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.