| Name |
5,6-Dihydro-2,3-dimethoxy-8H-benzo[a][1,3]benzodioxolo[5,6-g]quinolizin-8-one
|
| Molecular Formula |
C20H17NO5
|
| Molecular Weight |
351.4
|
| Smiles |
COc1cc2c(cc1OC)-c1cc3cc4c(cc3c(=O)n1CC2)OCO4
|
COc1cc2c(cc1OC)-c1cc3cc4c(cc3c(=O)n1CC2)OCO4
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.