| Name |
(2R)-2-amino-4-cyano-5,5,5-trifluoropentanoic acid
|
| Molecular Formula |
C6H7F3N2O2
|
| Molecular Weight |
196.13
|
| Smiles |
N#CC(CC(N)C(=O)O)C(F)(F)F
|
N#CC(CC(N)C(=O)O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.