| Name |
4-[(5-{3-Ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl}-octahydropyrrolo[3,4-c]pyrrol-2-yl)sulfonyl]-3,5-dimethyl-1,2-oxazole
|
| Molecular Formula |
C18H23N7O3S
|
| Molecular Weight |
417.5
|
| Smiles |
CCc1nnc2ccc(N3CC4CN(S(=O)(=O)c5c(C)noc5C)CC4C3)nn12
|
CCc1nnc2ccc(N3CC4CN(S(=O)(=O)c5c(C)noc5C)CC4C3)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.