| Name |
ethyl 4-{5-[(1S)-1-amino-2-methyl-2-sulfanylpropyl]-1,2,4-oxadiazol-3-yl}piperazine-1-carboxylate
|
| Molecular Formula |
C13H23N5O3S
|
| Molecular Weight |
329.42
|
| Smiles |
CCOC(=O)N1CCN(c2noc(C(N)C(C)(C)S)n2)CC1
|
CCOC(=O)N1CCN(c2noc(C(N)C(C)(C)S)n2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.