| Name |
3-amino-6-bromo-2,3-dihydro-1H-indol-2-one hydrochloride
|
| Molecular Formula |
C8H8BrClN2O
|
| Molecular Weight |
263.52
|
| Smiles |
Cl.NC1C(=O)Nc2cc(Br)ccc21
|
Cl.NC1C(=O)Nc2cc(Br)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.