| Name |
tert-butyl 3-{4-ethyl-4H,5H,6H,7H-furo[3,2-c]pyridin-4-yl}azetidine-1-carboxylate
|
| Molecular Formula |
C17H26N2O3
|
| Molecular Weight |
306.4
|
| Smiles |
CCC1(C2CN(C(=O)OC(C)(C)C)C2)NCCc2occc21
|
CCC1(C2CN(C(=O)OC(C)(C)C)C2)NCCc2occc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.