| Name |
4,4-dioxo-1-(2,2,2-trifluoroacetyl)-1H,2H,3H-4lambda6-pyrido[2,3-b][1,4]thiazine-7-carboxylic acid
|
| Molecular Formula |
C10H7F3N2O5S
|
| Molecular Weight |
324.24
|
| Smiles |
O=C(O)c1cnc2c(c1)N(C(=O)C(F)(F)F)CCS2(=O)=O
|
O=C(O)c1cnc2c(c1)N(C(=O)C(F)(F)F)CCS2(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.