| Name |
D-Ribose, 2-C-(hydroxymethyl)-, 5-(3,4,5-trihydroxybenzoate)
|
| Molecular Formula |
C13H16O10
|
| Molecular Weight |
332.26
|
| Smiles |
O=CC(O)(CO)C(O)C(O)COC(=O)c1cc(O)c(O)c(O)c1
|
O=CC(O)(CO)C(O)C(O)COC(=O)c1cc(O)c(O)c(O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.