| Name |
N-{6',7'-dihydrospiro[azetidine-3,5'-pyrrolo[1,2-a]imidazole]-7'-yl}propanamide
|
| Molecular Formula |
C11H16N4O
|
| Molecular Weight |
220.27
|
| Smiles |
CCC(=O)NC1CC2(CNC2)n2ccnc21
|
CCC(=O)NC1CC2(CNC2)n2ccnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.