| Name |
1'-[(tert-butoxy)carbonyl]-5-{[(9H-fluoren-9-yl)methoxy]carbonyl}-hexahydrospiro[furo[3,4-c]pyrrole-1,4'-piperidine]-3a-carboxylic acid
|
| Molecular Formula |
C31H36N2O7
|
| Molecular Weight |
548.6
|
| Smiles |
CC(C)(C)OC(=O)N1CCC2(CC1)OCC1(C(=O)O)CN(C(=O)OCC3c4ccccc4-c4ccccc43)CC21
|
CC(C)(C)OC(=O)N1CCC2(CC1)OCC1(C(=O)O)CN(C(=O)OCC3c4ccccc4-c4ccccc43)CC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.