| Name |
1-Piperidinecarboxylic acid, 4-chloro-4-cyano-, 1,1-dimethylethyl ester
|
| Molecular Formula |
C11H17ClN2O2
|
| Molecular Weight |
244.72
|
| Smiles |
CC(C)(C)OC(=O)N1CCC(Cl)(C#N)CC1
|
CC(C)(C)OC(=O)N1CCC(Cl)(C#N)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.