| Name |
3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-{[(5-methyl-1,3-oxazol-4-yl)methyl]carbamoyl}propanoic acid
|
| Molecular Formula |
C24H23N3O6
|
| Molecular Weight |
449.5
|
| Smiles |
Cc1ocnc1CNC(=O)C(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21
|
Cc1ocnc1CNC(=O)C(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.