| Name |
3-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}-2,2-difluoropropan-1-amine
|
| Molecular Formula |
C12H19F2N
|
| Molecular Weight |
215.28
|
| Smiles |
CC1(C)C2CC=C(CC(F)(F)CN)C1C2
|
CC1(C)C2CC=C(CC(F)(F)CN)C1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.