| Name |
2,2-Dichloro-1-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid
|
| Molecular Formula |
C10H6Cl4O2
|
| Molecular Weight |
300.0
|
| Smiles |
O=C(O)C1(c2ccc(Cl)c(Cl)c2)CC1(Cl)Cl
|
O=C(O)C1(c2ccc(Cl)c(Cl)c2)CC1(Cl)Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.