| Name |
2-[4-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetyl)-2-oxopiperazin-1-yl]acetic acid
|
| Molecular Formula |
C25H27N3O6S
|
| Molecular Weight |
497.6
|
| Smiles |
O=C(O)CN1CCN(C(=O)CSCCNC(=O)OCC2c3ccccc3-c3ccccc32)CC1=O
|
O=C(O)CN1CCN(C(=O)CSCCNC(=O)OCC2c3ccccc3-c3ccccc32)CC1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.