| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 4H,6H,7H-thieno[3,2-c]pyran-2-carboxylate
|
| Molecular Formula |
C16H11NO5S
|
| Molecular Weight |
329.3
|
| Smiles |
O=C(ON1C(=O)c2ccccc2C1=O)c1cc2c(s1)CCOC2
|
O=C(ON1C(=O)c2ccccc2C1=O)c1cc2c(s1)CCOC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.